C14H11N3O2 — CID 82375479
7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 82375479) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine-6-carboxylic acid.
| Compound Name | 7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 82375479 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine-6-carboxylic acid |
| SMILES | Cn1c(C(=O)O)cc2c(-c3ccccc3)ncnc21 |
| InChI | InChI=1S/C14H11N3O2/c1-17-11(14(18)19)7-10-12(15-8-16-13(10)17)9-5-3-2-4-6-9/h2-8H,1H3,(H,18,19) |
| InChIKey | QXPOXPUHVVLAQS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |