C15H17N5 — CID 122208510
1,1-dimethyl-2-(7-methyl-6-phenylpyrrolo[2,3-d]pyrimidin-4-yl)hydrazine (PubChem CID 122208510) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is 1,1-dimethyl-2-(7-methyl-6-phenylpyrrolo[2,3-d]pyrimidin-4-yl)hydrazine.
| Compound Name | 1,1-dimethyl-2-(7-methyl-6-phenylpyrrolo[2,3-d]pyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 122208510 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 1,1-dimethyl-2-(7-methyl-6-phenylpyrrolo[2,3-d]pyrimidin-4-yl)hydrazine |
| SMILES | CN(C)Nc1ncnc2c1cc(-c1ccccc1)n2C |
| InChI | InChI=1S/C15H17N5/c1-19(2)18-14-12-9-13(11-7-5-4-6-8-11)20(3)15(12)17-10-16-14/h4-10H,1-3H3,(H,16,17,18) |
| InChIKey | BINDJKFCEIAFAI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|