About 2-methyl-3-oxo-4H-thieno[3,4-b][1,4]oxazine-5-carboxylic acid
2-methyl-3-oxo-4H-thieno[3,4-b][1,4]oxazine-5-carboxylic acid (PubChem CID 82376415) has the molecular formula C8H7NO4S
and a molecular weight of 213.21 g/mol. Its IUPAC name is 2-methyl-3-oxo-4H-thieno[3,4-b][1,4]oxazine-5-carboxylic acid.
Analyze 2-methyl-3-oxo-4H-thieno[3,4-b][1,4]oxazine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-oxo-4H-thieno[3,4-b][1,4]oxazine-5-carboxylic acid?
The IUPAC name of 2-methyl-3-oxo-4H-thieno[3,4-b][1,4]oxazine-5-carboxylic acid (CID 82376415) is 2-methyl-3-oxo-4H-thieno[3,4-b][1,4]oxazine-5-carboxylic acid.
What is the SMILES notation for 2-methyl-3-oxo-4H-thieno[3,4-b][1,4]oxazine-5-carboxylic acid?
The canonical SMILES for 2-methyl-3-oxo-4H-thieno[3,4-b][1,4]oxazine-5-carboxylic acid is CC1Oc2csc(C(=O)O)c2NC1=O.
What is the InChIKey of 2-methyl-3-oxo-4H-thieno[3,4-b][1,4]oxazine-5-carboxylic acid?
The InChIKey is ASENDWCDYZKLEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO4S/c1-3-7(10)9-5-4(13-3)2-14-6(5)8(11)12/h2-3H,1H3,(H,9,10)(H,11,12).
What are the key properties of 2-methyl-3-oxo-4H-thieno[3,4-b][1,4]oxazine-5-carboxylic acid?
2-methyl-3-oxo-4H-thieno[3,4-b][1,4]oxazine-5-carboxylic acid has a molecular weight of 213.21 g/mol, XLogP of 1.17, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-oxo-4H-thieno[3,4-b][1,4]oxazine-5-carboxylic acid is sourced from PubChem (CID 82376415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).