3-ethyl-7-propan-2-yl-1-benzofuran-2-sulfonyl chloride

C13H15ClO3S — CID 82378293

IUPAC3-ethyl-7-propan-2-yl-1-benzofuran-2-sulfonyl chloride
SMILESCCc1c(S(=O)(=O)Cl)oc2c(C(C)C)cccc12
InChIInChI=1S/C13H15ClO3S/c1-4-9-11-7-5-6-10(8(2)3)12(11)17-13(9)18(14,15)16/h5-8H,4H2,1-3H3
InChIKeyBHRQZHPSZWAMMR-UHFFFAOYSA-N
MW286.78 g/mol
LogP4.05
Rot. Bonds3

About 3-ethyl-7-propan-2-yl-1-benzofuran-2-sulfonyl chloride

3-ethyl-7-propan-2-yl-1-benzofuran-2-sulfonyl chloride (PubChem CID 82378293) has the molecular formula C13H15ClO3S and a molecular weight of 286.78 g/mol. Its IUPAC name is 3-ethyl-7-propan-2-yl-1-benzofuran-2-sulfonyl chloride.

Molecular Properties

Compound Name3-ethyl-7-propan-2-yl-1-benzofuran-2-sulfonyl chloride
PubChem CID82378293
Molecular FormulaC13H15ClO3S
Molecular Weight286.78 g/mol
Exact Mass286.04
IUPAC Name3-ethyl-7-propan-2-yl-1-benzofuran-2-sulfonyl chloride
SMILESCCc1c(S(=O)(=O)Cl)oc2c(C(C)C)cccc12
InChIInChI=1S/C13H15ClO3S/c1-4-9-11-7-5-6-10(8(2)3)12(11)17-13(9)18(14,15)16/h5-8H,4H2,1-3H3
InChIKeyBHRQZHPSZWAMMR-UHFFFAOYSA-N
XLogP4.05
TPSA47.28 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.78
LogP ≤ 54.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 3-ethyl-7-propan-2-yl-1-benzofuran-2-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethyl-7-propan-2-yl-1-benzofuran-2-sulfonyl chloride?
The IUPAC name of 3-ethyl-7-propan-2-yl-1-benzofuran-2-sulfonyl chloride (CID 82378293) is 3-ethyl-7-propan-2-yl-1-benzofuran-2-sulfonyl chloride.
What is the SMILES notation for 3-ethyl-7-propan-2-yl-1-benzofuran-2-sulfonyl chloride?
The canonical SMILES for 3-ethyl-7-propan-2-yl-1-benzofuran-2-sulfonyl chloride is CCc1c(S(=O)(=O)Cl)oc2c(C(C)C)cccc12.
What is the InChIKey of 3-ethyl-7-propan-2-yl-1-benzofuran-2-sulfonyl chloride?
The InChIKey is BHRQZHPSZWAMMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClO3S/c1-4-9-11-7-5-6-10(8(2)3)12(11)17-13(9)18(14,15)16/h5-8H,4H2,1-3H3.
What are the key properties of 3-ethyl-7-propan-2-yl-1-benzofuran-2-sulfonyl chloride?
3-ethyl-7-propan-2-yl-1-benzofuran-2-sulfonyl chloride has a molecular weight of 286.78 g/mol, XLogP of 4.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-7-propan-2-yl-1-benzofuran-2-sulfonyl chloride is sourced from PubChem (CID 82378293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).