C12H19BrN2 — CID 82379119
4-(2-bromophenyl)-1-N,1-N-dimethylbutane-1,3-diamine (PubChem CID 82379119) has the molecular formula C12H19BrN2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 4-(2-bromophenyl)-1-N,1-N-dimethylbutane-1,3-diamine.
| Compound Name | 4-(2-bromophenyl)-1-N,1-N-dimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 82379119 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-(2-bromophenyl)-1-N,1-N-dimethylbutane-1,3-diamine |
| SMILES | CN(C)CCC(N)Cc1ccccc1Br |
| InChI | InChI=1S/C12H19BrN2/c1-15(2)8-7-11(14)9-10-5-3-4-6-12(10)13/h3-6,11H,7-9,14H2,1-2H3 |
| InChIKey | DXOLGJFIFDHEMP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |