C14H27N3O2 — CID 82379344
tert-butyl N-[(2S,3R)-2-piperidin-3-ylpyrrolidin-3-yl]carbamate (PubChem CID 82379344) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-2-piperidin-3-ylpyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-2-piperidin-3-ylpyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 82379344 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | tert-butyl N-[(2S,3R)-2-piperidin-3-ylpyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN[C@H]1C1CCCNC1 |
| InChI | InChI=1S/C14H27N3O2/c1-14(2,3)19-13(18)17-11-6-8-16-12(11)10-5-4-7-15-9-10/h10-12,15-16H,4-9H2,1-3H3,(H,17,18)/t10?,11-,12+/m1/s1 |
| InChIKey | ZWYNIXZDVBSHQB-SAIIYOCFSA-N |
| XLogP | 1.24 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |