C12H24N2O2S — CID 82380097
tert-butyl (2S)-3-amino-2-(2-methylsulfanylethyl)pyrrolidine-1-carboxylate (PubChem CID 82380097) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is tert-butyl (2S)-3-amino-2-(2-methylsulfanylethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-3-amino-2-(2-methylsulfanylethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 82380097 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | tert-butyl (2S)-3-amino-2-(2-methylsulfanylethyl)pyrrolidine-1-carboxylate |
| SMILES | CSCC[C@H]1C(N)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H24N2O2S/c1-12(2,3)16-11(15)14-7-5-9(13)10(14)6-8-17-4/h9-10H,5-8,13H2,1-4H3/t9?,10-/m0/s1 |
| InChIKey | QDKHPBOZJPZPRE-AXDSSHIGSA-N |
| XLogP | 2.08 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |