2-(2,4-dimethyl-1H-indol-3-yl)-1H-pyrrole-3-carboxylic acid

C15H14N2O2 — CID 82381368

IUPAC2-(2,4-dimethyl-1H-indol-3-yl)-1H-pyrrole-3-carboxylic acid
SMILESCc1[nH]c2cccc(C)c2c1-c1[nH]ccc1C(=O)O
InChIInChI=1S/C15H14N2O2/c1-8-4-3-5-11-12(8)13(9(2)17-11)14-10(15(18)19)6-7-16-14/h3-7,16-17H,1-2H3,(H,18,19)
InChIKeyNNJJSXIJVGLABL-UHFFFAOYSA-N
MW254.29 g/mol
LogP3.48
Rot. Bonds2

About 2-(2,4-dimethyl-1H-indol-3-yl)-1H-pyrrole-3-carboxylic acid

2-(2,4-dimethyl-1H-indol-3-yl)-1H-pyrrole-3-carboxylic acid (PubChem CID 82381368) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(2,4-dimethyl-1H-indol-3-yl)-1H-pyrrole-3-carboxylic acid.

Molecular Properties

Compound Name2-(2,4-dimethyl-1H-indol-3-yl)-1H-pyrrole-3-carboxylic acid
PubChem CID82381368
Molecular FormulaC15H14N2O2
Molecular Weight254.29 g/mol
Exact Mass254.11
IUPAC Name2-(2,4-dimethyl-1H-indol-3-yl)-1H-pyrrole-3-carboxylic acid
SMILESCc1[nH]c2cccc(C)c2c1-c1[nH]ccc1C(=O)O
InChIInChI=1S/C15H14N2O2/c1-8-4-3-5-11-12(8)13(9(2)17-11)14-10(15(18)19)6-7-16-14/h3-7,16-17H,1-2H3,(H,18,19)
InChIKeyNNJJSXIJVGLABL-UHFFFAOYSA-N
XLogP3.48
TPSA68.88 Ų
H-Bond Donors3
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.29
LogP ≤ 53.48
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 101

Analyze 2-(2,4-dimethyl-1H-indol-3-yl)-1H-pyrrole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-dimethyl-1H-indol-3-yl)-1H-pyrrole-3-carboxylic acid?
The IUPAC name of 2-(2,4-dimethyl-1H-indol-3-yl)-1H-pyrrole-3-carboxylic acid (CID 82381368) is 2-(2,4-dimethyl-1H-indol-3-yl)-1H-pyrrole-3-carboxylic acid.
What is the SMILES notation for 2-(2,4-dimethyl-1H-indol-3-yl)-1H-pyrrole-3-carboxylic acid?
The canonical SMILES for 2-(2,4-dimethyl-1H-indol-3-yl)-1H-pyrrole-3-carboxylic acid is Cc1[nH]c2cccc(C)c2c1-c1[nH]ccc1C(=O)O.
What is the InChIKey of 2-(2,4-dimethyl-1H-indol-3-yl)-1H-pyrrole-3-carboxylic acid?
The InChIKey is NNJJSXIJVGLABL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2/c1-8-4-3-5-11-12(8)13(9(2)17-11)14-10(15(18)19)6-7-16-14/h3-7,16-17H,1-2H3,(H,18,19).
What are the key properties of 2-(2,4-dimethyl-1H-indol-3-yl)-1H-pyrrole-3-carboxylic acid?
2-(2,4-dimethyl-1H-indol-3-yl)-1H-pyrrole-3-carboxylic acid has a molecular weight of 254.29 g/mol, XLogP of 3.48, 2 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethyl-1H-indol-3-yl)-1H-pyrrole-3-carboxylic acid is sourced from PubChem (CID 82381368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).