C20H21FN2O — CID 87577227
4-(2,4-dimethyl-1H-indol-3-yl)-3-ethyl-5-fluoro-2-methylbenzamide (PubChem CID 87577227) has the molecular formula C20H21FN2O and a molecular weight of 324.40 g/mol. Its IUPAC name is 4-(2,4-dimethyl-1H-indol-3-yl)-3-ethyl-5-fluoro-2-methylbenzamide.
| Compound Name | 4-(2,4-dimethyl-1H-indol-3-yl)-3-ethyl-5-fluoro-2-methylbenzamide |
|---|---|
| PubChem CID | 87577227 |
| Molecular Formula | C20H21FN2O |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-(2,4-dimethyl-1H-indol-3-yl)-3-ethyl-5-fluoro-2-methylbenzamide |
| SMILES | CCc1c(C)c(C(N)=O)cc(F)c1-c1c(C)[nH]c2cccc(C)c12 |
| InChI | InChI=1S/C20H21FN2O/c1-5-13-11(3)14(20(22)24)9-15(21)19(13)18-12(4)23-16-8-6-7-10(2)17(16)18/h6-9,23H,5H2,1-4H3,(H2,22,24) |
| InChIKey | GQGUQMLPEFBXQR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |