C11H9N3O2S — CID 82383993
2-(1,5-dimethylpyrazol-4-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde (PubChem CID 82383993) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-(1,5-dimethylpyrazol-4-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde.
| Compound Name | 2-(1,5-dimethylpyrazol-4-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 82383993 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 2-(1,5-dimethylpyrazol-4-yl)thieno[3,4-d][1,3]oxazole-4-carbaldehyde |
| SMILES | Cc1c(-c2nc3c(C=O)scc3o2)cnn1C |
| InChI | InChI=1S/C11H9N3O2S/c1-6-7(3-12-14(6)2)11-13-10-8(16-11)5-17-9(10)4-15/h3-5H,1-2H3 |
| InChIKey | RCXRFPPSBYXZAX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|