C12H14N4O2 — CID 82384540
4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid (PubChem CID 82384540) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid.
| Compound Name | 4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 82384540 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid |
| SMILES | O=C(O)C1CN(c2ccc3cccnn23)CCN1 |
| InChI | InChI=1S/C12H14N4O2/c17-12(18)10-8-15(7-6-13-10)11-4-3-9-2-1-5-14-16(9)11/h1-5,10,13H,6-8H2,(H,17,18) |
| InChIKey | OWFZQRPBLMUDFL-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |