About 4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid
4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid (PubChem CID 82384540) has the molecular formula C12H14N4O2
and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid |
| PubChem CID | 82384540 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid |
| SMILES | O=C(O)C1CN(c2ccc3cccnn23)CCN1 |
| InChI | InChI=1S/C12H14N4O2/c17-12(18)10-8-15(7-6-13-10)11-4-3-9-2-1-5-14-16(9)11/h1-5,10,13H,6-8H2,(H,17,18) |
| InChIKey | OWFZQRPBLMUDFL-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid?
The IUPAC name of 4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid (CID 82384540) is 4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid.
What is the SMILES notation for 4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid?
The canonical SMILES for 4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid is O=C(O)C1CN(c2ccc3cccnn23)CCN1.
What is the InChIKey of 4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid?
The InChIKey is OWFZQRPBLMUDFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2/c17-12(18)10-8-15(7-6-13-10)11-4-3-9-2-1-5-14-16(9)11/h1-5,10,13H,6-8H2,(H,17,18).
What are the key properties of 4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid?
4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid has a molecular weight of 246.27 g/mol, XLogP of 0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrrolo[1,2-b]pyridazin-7-ylpiperazine-2-carboxylic acid is sourced from PubChem (CID 82384540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).