2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid

C11H6N2O3S — CID 82384640

IUPAC2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid
SMILESO=C(O)c1csc(-c2cc3cccnc3o2)n1
InChIInChI=1S/C11H6N2O3S/c14-11(15)7-5-17-10(13-7)8-4-6-2-1-3-12-9(6)16-8/h1-5H,(H,14,15)
InChIKeyFGNLMLJFCDJJLG-UHFFFAOYSA-N
MW246.25 g/mol
LogP2.65
Rot. Bonds2

About 2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid

2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid (PubChem CID 82384640) has the molecular formula C11H6N2O3S and a molecular weight of 246.25 g/mol. Its IUPAC name is 2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid
PubChem CID82384640
Molecular FormulaC11H6N2O3S
Molecular Weight246.25 g/mol
Exact Mass246.01
IUPAC Name2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid
SMILESO=C(O)c1csc(-c2cc3cccnc3o2)n1
InChIInChI=1S/C11H6N2O3S/c14-11(15)7-5-17-10(13-7)8-4-6-2-1-3-12-9(6)16-8/h1-5H,(H,14,15)
InChIKeyFGNLMLJFCDJJLG-UHFFFAOYSA-N
XLogP2.65
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.25
LogP ≤ 52.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid (CID 82384640) is 2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid is O=C(O)c1csc(-c2cc3cccnc3o2)n1.
What is the InChIKey of 2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid?
The InChIKey is FGNLMLJFCDJJLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N2O3S/c14-11(15)7-5-17-10(13-7)8-4-6-2-1-3-12-9(6)16-8/h1-5H,(H,14,15).
What are the key properties of 2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid?
2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid has a molecular weight of 246.25 g/mol, XLogP of 2.65, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 82384640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).