C11H6N2O3S — CID 82384640
2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid (PubChem CID 82384640) has the molecular formula C11H6N2O3S and a molecular weight of 246.25 g/mol. Its IUPAC name is 2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82384640 |
| Molecular Formula | C11H6N2O3S |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 2-furo[2,3-b]pyridin-2-yl-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(-c2cc3cccnc3o2)n1 |
| InChI | InChI=1S/C11H6N2O3S/c14-11(15)7-5-17-10(13-7)8-4-6-2-1-3-12-9(6)16-8/h1-5H,(H,14,15) |
| InChIKey | FGNLMLJFCDJJLG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |