C13H16N4O — CID 82385685
5-(3H-benzimidazol-5-yl)-3,3-dimethylpiperazin-2-one (PubChem CID 82385685) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 5-(3H-benzimidazol-5-yl)-3,3-dimethylpiperazin-2-one.
| Compound Name | 5-(3H-benzimidazol-5-yl)-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 82385685 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 5-(3H-benzimidazol-5-yl)-3,3-dimethylpiperazin-2-one |
| SMILES | CC1(C)NC(c2ccc3nc[nH]c3c2)CNC1=O |
| InChI | InChI=1S/C13H16N4O/c1-13(2)12(18)14-6-11(17-13)8-3-4-9-10(5-8)16-7-15-9/h3-5,7,11,17H,6H2,1-2H3,(H,14,18)(H,15,16) |
| InChIKey | RLFBSBKLJPUWBU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |