C13H13FN4 — CID 82385817
2-(1,3-dimethylpyrazol-4-yl)-5-fluoro-1H-indol-6-amine (PubChem CID 82385817) has the molecular formula C13H13FN4 and a molecular weight of 244.27 g/mol. Its IUPAC name is 2-(1,3-dimethylpyrazol-4-yl)-5-fluoro-1H-indol-6-amine.
| Compound Name | 2-(1,3-dimethylpyrazol-4-yl)-5-fluoro-1H-indol-6-amine |
|---|---|
| PubChem CID | 82385817 |
| Molecular Formula | C13H13FN4 |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2-(1,3-dimethylpyrazol-4-yl)-5-fluoro-1H-indol-6-amine |
| SMILES | Cc1nn(C)cc1-c1cc2cc(F)c(N)cc2[nH]1 |
| InChI | InChI=1S/C13H13FN4/c1-7-9(6-18(2)17-7)13-4-8-3-10(14)11(15)5-12(8)16-13/h3-6,16H,15H2,1-2H3 |
| InChIKey | RFFATXWUIBPVIU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|