About 3-(5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl)piperidine
3-(5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl)piperidine (PubChem CID 82388218) has the molecular formula C12H17NS2
and a molecular weight of 239.41 g/mol. Its IUPAC name is 3-(5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl)piperidine.
Molecular Properties
| Compound Name | 3-(5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl)piperidine |
| PubChem CID | 82388218 |
| Molecular Formula | C12H17NS2 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 3-(5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl)piperidine |
| SMILES | c1c(C2CCCNC2)sc2c1CCCS2 |
| InChI | InChI=1S/C12H17NS2/c1-3-10(8-13-5-1)11-7-9-4-2-6-14-12(9)15-11/h7,10,13H,1-6,8H2 |
| InChIKey | WAJGFIQMJVMSFW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl)piperidine?
The IUPAC name of 3-(5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl)piperidine (CID 82388218) is 3-(5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl)piperidine.
What is the SMILES notation for 3-(5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl)piperidine?
The canonical SMILES for 3-(5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl)piperidine is c1c(C2CCCNC2)sc2c1CCCS2.
What is the InChIKey of 3-(5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl)piperidine?
The InChIKey is WAJGFIQMJVMSFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NS2/c1-3-10(8-13-5-1)11-7-9-4-2-6-14-12(9)15-11/h7,10,13H,1-6,8H2.
What are the key properties of 3-(5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl)piperidine?
3-(5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl)piperidine has a molecular weight of 239.41 g/mol, XLogP of 3.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl)piperidine is sourced from PubChem (CID 82388218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).