C14H27N3 — CID 82388905
1-[[(2R,3R)-2-cyclopentylpyrrolidin-3-yl]methyl]piperazine (PubChem CID 82388905) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is 1-[[(2R,3R)-2-cyclopentylpyrrolidin-3-yl]methyl]piperazine.
| Compound Name | 1-[[(2R,3R)-2-cyclopentylpyrrolidin-3-yl]methyl]piperazine |
|---|---|
| PubChem CID | 82388905 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 1-[[(2R,3R)-2-cyclopentylpyrrolidin-3-yl]methyl]piperazine |
| SMILES | C1CCC([C@H]2NCC[C@@H]2CN2CCNCC2)C1 |
| InChI | InChI=1S/C14H27N3/c1-2-4-12(3-1)14-13(5-6-16-14)11-17-9-7-15-8-10-17/h12-16H,1-11H2/t13-,14-/m1/s1 |
| InChIKey | QQLBBNGLWYGOLZ-ZIAGYGMSSA-N |
| XLogP | 1.06 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |