C12H11NO2S — CID 82390025
2,4-dimethyl-5-(thiophene-2-carbonyl)-1H-pyrrole-3-carbaldehyde (PubChem CID 82390025) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is 2,4-dimethyl-5-(thiophene-2-carbonyl)-1H-pyrrole-3-carbaldehyde.
| Compound Name | 2,4-dimethyl-5-(thiophene-2-carbonyl)-1H-pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 82390025 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 2,4-dimethyl-5-(thiophene-2-carbonyl)-1H-pyrrole-3-carbaldehyde |
| SMILES | Cc1[nH]c(C(=O)c2cccs2)c(C)c1C=O |
| InChI | InChI=1S/C12H11NO2S/c1-7-9(6-14)8(2)13-11(7)12(15)10-4-3-5-16-10/h3-6,13H,1-2H3 |
| InChIKey | DMZWWJKWYKMMND-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|