C8H7BrN2O — CID 82391440
5-bromo-2-methoxyimidazo[1,2-a]pyridine (PubChem CID 82391440) has the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. Its IUPAC name is 5-bromo-2-methoxyimidazo[1,2-a]pyridine.
| Compound Name | 5-bromo-2-methoxyimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 82391440 |
| Molecular Formula | C8H7BrN2O |
| Molecular Weight | 227.06 g/mol |
| Exact Mass | 225.97 |
| IUPAC Name | 5-bromo-2-methoxyimidazo[1,2-a]pyridine |
| SMILES | COc1cn2c(Br)cccc2n1 |
| InChI | InChI=1S/C8H7BrN2O/c1-12-8-5-11-6(9)3-2-4-7(11)10-8/h2-5H,1H3 |
| InChIKey | DKWLRUNIXAQGLF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.06 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|