C8H10N4O2S — CID 82391500
6-(methylsulfonylmethyl)pyrazolo[1,5-a]pyrimidin-2-amine (PubChem CID 82391500) has the molecular formula C8H10N4O2S and a molecular weight of 226.26 g/mol. Its IUPAC name is 6-(methylsulfonylmethyl)pyrazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | 6-(methylsulfonylmethyl)pyrazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 82391500 |
| Molecular Formula | C8H10N4O2S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 6-(methylsulfonylmethyl)pyrazolo[1,5-a]pyrimidin-2-amine |
| SMILES | CS(=O)(=O)Cc1cnc2cc(N)nn2c1 |
| InChI | InChI=1S/C8H10N4O2S/c1-15(13,14)5-6-3-10-8-2-7(9)11-12(8)4-6/h2-4H,5H2,1H3,(H2,9,11) |
| InChIKey | BIKNFRTZPJKZLA-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |