C10H14FN3 — CID 163226180
ethane;6-ethyl-2-fluoropyrazolo[1,5-a]pyrimidine (PubChem CID 163226180) has the molecular formula C10H14FN3 and a molecular weight of 195.24 g/mol. Its IUPAC name is ethane;6-ethyl-2-fluoropyrazolo[1,5-a]pyrimidine.
| Compound Name | ethane;6-ethyl-2-fluoropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 163226180 |
| Molecular Formula | C10H14FN3 |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | ethane;6-ethyl-2-fluoropyrazolo[1,5-a]pyrimidine |
| SMILES | CC.CCc1cnc2cc(F)nn2c1 |
| InChI | InChI=1S/C8H8FN3.C2H6/c1-2-6-4-10-8-3-7(9)11-12(8)5-6;1-2/h3-5H,2H2,1H3;1-2H3 |
| InChIKey | RRQOUYCACMWIKF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |