C9H10N4O2 — CID 82396060
2-(2-aminoethyl)-6-methylpyrrolo[3,4-d]pyrimidine-5,7-dione (PubChem CID 82396060) has the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. Its IUPAC name is 2-(2-aminoethyl)-6-methylpyrrolo[3,4-d]pyrimidine-5,7-dione.
| Compound Name | 2-(2-aminoethyl)-6-methylpyrrolo[3,4-d]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 82396060 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2-(2-aminoethyl)-6-methylpyrrolo[3,4-d]pyrimidine-5,7-dione |
| SMILES | CN1C(=O)c2cnc(CCN)nc2C1=O |
| InChI | InChI=1S/C9H10N4O2/c1-13-8(14)5-4-11-6(2-3-10)12-7(5)9(13)15/h4H,2-3,10H2,1H3 |
| InChIKey | JPGUXGJXZSLZPT-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|