2-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,2]oxazol-3-yl)acetic acid

C10H13NO3 — CID 82400503

IUPAC2-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,2]oxazol-3-yl)acetic acid
SMILESO=C(O)Cc1noc2c1CCCCC2
InChIInChI=1S/C10H13NO3/c12-10(13)6-8-7-4-2-1-3-5-9(7)14-11-8/h1-6H2,(H,12,13)
InChIKeyRLSZXCGENVFOGQ-UHFFFAOYSA-N
MW195.22 g/mol
LogP1.57
Rot. Bonds2

About 2-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,2]oxazol-3-yl)acetic acid

2-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,2]oxazol-3-yl)acetic acid (PubChem CID 82400503) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,2]oxazol-3-yl)acetic acid.

Molecular Properties

Compound Name2-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,2]oxazol-3-yl)acetic acid
PubChem CID82400503
Molecular FormulaC10H13NO3
Molecular Weight195.22 g/mol
Exact Mass195.09
IUPAC Name2-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,2]oxazol-3-yl)acetic acid
SMILESO=C(O)Cc1noc2c1CCCCC2
InChIInChI=1S/C10H13NO3/c12-10(13)6-8-7-4-2-1-3-5-9(7)14-11-8/h1-6H2,(H,12,13)
InChIKeyRLSZXCGENVFOGQ-UHFFFAOYSA-N
XLogP1.57
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.22
LogP ≤ 51.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,2]oxazol-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,2]oxazol-3-yl)acetic acid?
The IUPAC name of 2-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,2]oxazol-3-yl)acetic acid (CID 82400503) is 2-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,2]oxazol-3-yl)acetic acid.
What is the SMILES notation for 2-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,2]oxazol-3-yl)acetic acid?
The canonical SMILES for 2-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,2]oxazol-3-yl)acetic acid is O=C(O)Cc1noc2c1CCCCC2.
What is the InChIKey of 2-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,2]oxazol-3-yl)acetic acid?
The InChIKey is RLSZXCGENVFOGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c12-10(13)6-8-7-4-2-1-3-5-9(7)14-11-8/h1-6H2,(H,12,13).
What are the key properties of 2-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,2]oxazol-3-yl)acetic acid?
2-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,2]oxazol-3-yl)acetic acid has a molecular weight of 195.22 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,2]oxazol-3-yl)acetic acid is sourced from PubChem (CID 82400503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).