C9H13NO — CID 89006897
3-ethyl-4,5,6,7-tetrahydro-1,2-benzoxazole (PubChem CID 89006897) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 3-ethyl-4,5,6,7-tetrahydro-1,2-benzoxazole.
| Compound Name | 3-ethyl-4,5,6,7-tetrahydro-1,2-benzoxazole |
|---|---|
| PubChem CID | 89006897 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 3-ethyl-4,5,6,7-tetrahydro-1,2-benzoxazole |
| SMILES | CCc1noc2c1CCCC2 |
| InChI | InChI=1S/C9H13NO/c1-2-8-7-5-3-4-6-9(7)11-10-8/h2-6H2,1H3 |
| InChIKey | NCPCOYWQHGTSIQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |