C11H12FNO — CID 82402127
9-fluoro-1-methyl-3,4-dihydro-2H-1-benzazepin-5-one (PubChem CID 82402127) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is 9-fluoro-1-methyl-3,4-dihydro-2H-1-benzazepin-5-one.
| Compound Name | 9-fluoro-1-methyl-3,4-dihydro-2H-1-benzazepin-5-one |
|---|---|
| PubChem CID | 82402127 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 9-fluoro-1-methyl-3,4-dihydro-2H-1-benzazepin-5-one |
| SMILES | CN1CCCC(=O)c2cccc(F)c21 |
| InChI | InChI=1S/C11H12FNO/c1-13-7-3-6-10(14)8-4-2-5-9(12)11(8)13/h2,4-5H,3,6-7H2,1H3 |
| InChIKey | NPWLYFNXQMSEKD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |