C8H11N5O — CID 82402149
3-methyl-5-(1,2,4-triazin-3-yl)piperazin-2-one (PubChem CID 82402149) has the molecular formula C8H11N5O and a molecular weight of 193.21 g/mol. Its IUPAC name is 3-methyl-5-(1,2,4-triazin-3-yl)piperazin-2-one.
| Compound Name | 3-methyl-5-(1,2,4-triazin-3-yl)piperazin-2-one |
|---|---|
| PubChem CID | 82402149 |
| Molecular Formula | C8H11N5O |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 3-methyl-5-(1,2,4-triazin-3-yl)piperazin-2-one |
| SMILES | CC1NC(c2nccnn2)CNC1=O |
| InChI | InChI=1S/C8H11N5O/c1-5-8(14)10-4-6(12-5)7-9-2-3-11-13-7/h2-3,5-6,12H,4H2,1H3,(H,10,14) |
| InChIKey | XUZYRGJOVQMAAH-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |