C13H16N2O3 — CID 82383520
(3S)-5-(4H-1,3-benzodioxin-8-yl)-3-methylpiperazin-2-one (PubChem CID 82383520) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is (3S)-5-(4H-1,3-benzodioxin-8-yl)-3-methylpiperazin-2-one.
| Compound Name | (3S)-5-(4H-1,3-benzodioxin-8-yl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 82383520 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (3S)-5-(4H-1,3-benzodioxin-8-yl)-3-methylpiperazin-2-one |
| SMILES | C[C@@H]1NC(c2cccc3c2OCOC3)CNC1=O |
| InChI | InChI=1S/C13H16N2O3/c1-8-13(16)14-5-11(15-8)10-4-2-3-9-6-17-7-18-12(9)10/h2-4,8,11,15H,5-7H2,1H3,(H,14,16)/t8-,11?/m0/s1 |
| InChIKey | RWSQHQKMBIYEAT-YMNIQAILSA-N |
| XLogP | 0.70 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |