C10H10O3 — CID 83874823
2-(4H-1,3-benzodioxin-8-yl)acetaldehyde (PubChem CID 83874823) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-(4H-1,3-benzodioxin-8-yl)acetaldehyde.
| Compound Name | 2-(4H-1,3-benzodioxin-8-yl)acetaldehyde |
|---|---|
| PubChem CID | 83874823 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 2-(4H-1,3-benzodioxin-8-yl)acetaldehyde |
| SMILES | O=CCc1cccc2c1OCOC2 |
| InChI | InChI=1S/C10H10O3/c11-5-4-8-2-1-3-9-6-12-7-13-10(8)9/h1-3,5H,4,6-7H2 |
| InChIKey | XDYWVSJFAXWYAO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|