C10H13NO2 — CID 82409644
2-(4H-1,3-benzodioxin-8-yl)ethanamine (PubChem CID 82409644) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-(4H-1,3-benzodioxin-8-yl)ethanamine.
| Compound Name | 2-(4H-1,3-benzodioxin-8-yl)ethanamine |
|---|---|
| PubChem CID | 82409644 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-(4H-1,3-benzodioxin-8-yl)ethanamine |
| SMILES | NCCc1cccc2c1OCOC2 |
| InChI | InChI=1S/C10H13NO2/c11-5-4-8-2-1-3-9-6-12-7-13-10(8)9/h1-3H,4-7,11H2 |
| InChIKey | LOPCAPQRTDVQOE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |