C11H15NOS — CID 83834611
2-(3,5-dihydro-2H-1,4-benzoxathiepin-9-yl)ethanamine (PubChem CID 83834611) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 2-(3,5-dihydro-2H-1,4-benzoxathiepin-9-yl)ethanamine.
| Compound Name | 2-(3,5-dihydro-2H-1,4-benzoxathiepin-9-yl)ethanamine |
|---|---|
| PubChem CID | 83834611 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-(3,5-dihydro-2H-1,4-benzoxathiepin-9-yl)ethanamine |
| SMILES | NCCc1cccc2c1OCCSC2 |
| InChI | InChI=1S/C11H15NOS/c12-5-4-9-2-1-3-10-8-14-7-6-13-11(9)10/h1-3H,4-8,12H2 |
| InChIKey | BDTSDFSODMFEDW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |