C10H12FNO2 — CID 83880036
2-(8-fluoro-4H-1,3-benzodioxin-6-yl)ethanamine (PubChem CID 83880036) has the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. Its IUPAC name is 2-(8-fluoro-4H-1,3-benzodioxin-6-yl)ethanamine.
| Compound Name | 2-(8-fluoro-4H-1,3-benzodioxin-6-yl)ethanamine |
|---|---|
| PubChem CID | 83880036 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-(8-fluoro-4H-1,3-benzodioxin-6-yl)ethanamine |
| SMILES | NCCc1cc(F)c2c(c1)COCO2 |
| InChI | InChI=1S/C10H12FNO2/c11-9-4-7(1-2-12)3-8-5-13-6-14-10(8)9/h3-4H,1-2,5-6,12H2 |
| InChIKey | BFHDJPJNBBWBAS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |