About 5-oxo-N-(1,2,4-triazin-3-yl)pyrrolidine-3-carboxamide
5-oxo-N-(1,2,4-triazin-3-yl)pyrrolidine-3-carboxamide (PubChem CID 114388995) has the molecular formula C8H9N5O2
and a molecular weight of 207.19 g/mol. Its IUPAC name is 5-oxo-N-(1,2,4-triazin-3-yl)pyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | 5-oxo-N-(1,2,4-triazin-3-yl)pyrrolidine-3-carboxamide |
| PubChem CID | 114388995 |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 5-oxo-N-(1,2,4-triazin-3-yl)pyrrolidine-3-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2nccnn2)CN1 |
| InChI | InChI=1S/C8H9N5O2/c14-6-3-5(4-10-6)7(15)12-8-9-1-2-11-13-8/h1-2,5H,3-4H2,(H,10,14)(H,9,12,13,15) |
| InChIKey | BPWSYXZUHUJPBQ-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-oxo-N-(1,2,4-triazin-3-yl)pyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-N-(1,2,4-triazin-3-yl)pyrrolidine-3-carboxamide?
The IUPAC name of 5-oxo-N-(1,2,4-triazin-3-yl)pyrrolidine-3-carboxamide (CID 114388995) is 5-oxo-N-(1,2,4-triazin-3-yl)pyrrolidine-3-carboxamide.
What is the SMILES notation for 5-oxo-N-(1,2,4-triazin-3-yl)pyrrolidine-3-carboxamide?
The canonical SMILES for 5-oxo-N-(1,2,4-triazin-3-yl)pyrrolidine-3-carboxamide is O=C1CC(C(=O)Nc2nccnn2)CN1.
What is the InChIKey of 5-oxo-N-(1,2,4-triazin-3-yl)pyrrolidine-3-carboxamide?
The InChIKey is BPWSYXZUHUJPBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5O2/c14-6-3-5(4-10-6)7(15)12-8-9-1-2-11-13-8/h1-2,5H,3-4H2,(H,10,14)(H,9,12,13,15).
What are the key properties of 5-oxo-N-(1,2,4-triazin-3-yl)pyrrolidine-3-carboxamide?
5-oxo-N-(1,2,4-triazin-3-yl)pyrrolidine-3-carboxamide has a molecular weight of 207.19 g/mol, XLogP of -1.05, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-N-(1,2,4-triazin-3-yl)pyrrolidine-3-carboxamide is sourced from PubChem (CID 114388995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).