C9H11N5O — CID 114387739
4-amino-N-(1,2,4-triazin-3-yl)cyclopent-2-ene-1-carboxamide (PubChem CID 114387739) has the molecular formula C9H11N5O and a molecular weight of 205.22 g/mol. Its IUPAC name is 4-amino-N-(1,2,4-triazin-3-yl)cyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-(1,2,4-triazin-3-yl)cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 114387739 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 4-amino-N-(1,2,4-triazin-3-yl)cyclopent-2-ene-1-carboxamide |
| SMILES | NC1C=CC(C(=O)Nc2nccnn2)C1 |
| InChI | InChI=1S/C9H11N5O/c10-7-2-1-6(5-7)8(15)13-9-11-3-4-12-14-9/h1-4,6-7H,5,10H2,(H,11,13,14,15) |
| InChIKey | MVNYMHYJQWLVSF-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|