2-(5,7-dimethylimidazo[1,2-a]imidazol-6-yl)acetic acid

C9H11N3O2 — CID 82402215

IUPAC2-(5,7-dimethylimidazo[1,2-a]imidazol-6-yl)acetic acid
SMILESCc1c(CC(=O)O)n(C)c2nccn12
InChIInChI=1S/C9H11N3O2/c1-6-7(5-8(13)14)11(2)9-10-3-4-12(6)9/h3-4H,5H2,1-2H3,(H,13,14)
InChIKeyXIOHCXBZTDJDCL-UHFFFAOYSA-N
MW193.21 g/mol
LogP0.61
Rot. Bonds2

About 2-(5,7-dimethylimidazo[1,2-a]imidazol-6-yl)acetic acid

2-(5,7-dimethylimidazo[1,2-a]imidazol-6-yl)acetic acid (PubChem CID 82402215) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-(5,7-dimethylimidazo[1,2-a]imidazol-6-yl)acetic acid.

Molecular Properties

Compound Name2-(5,7-dimethylimidazo[1,2-a]imidazol-6-yl)acetic acid
PubChem CID82402215
Molecular FormulaC9H11N3O2
Molecular Weight193.21 g/mol
Exact Mass193.09
IUPAC Name2-(5,7-dimethylimidazo[1,2-a]imidazol-6-yl)acetic acid
SMILESCc1c(CC(=O)O)n(C)c2nccn12
InChIInChI=1S/C9H11N3O2/c1-6-7(5-8(13)14)11(2)9-10-3-4-12(6)9/h3-4H,5H2,1-2H3,(H,13,14)
InChIKeyXIOHCXBZTDJDCL-UHFFFAOYSA-N
XLogP0.61
TPSA59.53 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.21
LogP ≤ 50.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(5,7-dimethylimidazo[1,2-a]imidazol-6-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5,7-dimethylimidazo[1,2-a]imidazol-6-yl)acetic acid?
The IUPAC name of 2-(5,7-dimethylimidazo[1,2-a]imidazol-6-yl)acetic acid (CID 82402215) is 2-(5,7-dimethylimidazo[1,2-a]imidazol-6-yl)acetic acid.
What is the SMILES notation for 2-(5,7-dimethylimidazo[1,2-a]imidazol-6-yl)acetic acid?
The canonical SMILES for 2-(5,7-dimethylimidazo[1,2-a]imidazol-6-yl)acetic acid is Cc1c(CC(=O)O)n(C)c2nccn12.
What is the InChIKey of 2-(5,7-dimethylimidazo[1,2-a]imidazol-6-yl)acetic acid?
The InChIKey is XIOHCXBZTDJDCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c1-6-7(5-8(13)14)11(2)9-10-3-4-12(6)9/h3-4H,5H2,1-2H3,(H,13,14).
What are the key properties of 2-(5,7-dimethylimidazo[1,2-a]imidazol-6-yl)acetic acid?
2-(5,7-dimethylimidazo[1,2-a]imidazol-6-yl)acetic acid has a molecular weight of 193.21 g/mol, XLogP of 0.61, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,7-dimethylimidazo[1,2-a]imidazol-6-yl)acetic acid is sourced from PubChem (CID 82402215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).