4-hydroxy-2-(1,2-thiazol-5-yl)butanoic acid

C7H9NO3S — CID 82405484

IUPAC4-hydroxy-2-(1,2-thiazol-5-yl)butanoic acid
SMILESO=C(O)C(CCO)c1ccns1
InChIInChI=1S/C7H9NO3S/c9-4-2-5(7(10)11)6-1-3-8-12-6/h1,3,5,9H,2,4H2,(H,10,11)
InChIKeyRHHFLBKGLSBCJH-UHFFFAOYSA-N
MW187.22 g/mol
LogP0.69
Rot. Bonds4

About 4-hydroxy-2-(1,2-thiazol-5-yl)butanoic acid

4-hydroxy-2-(1,2-thiazol-5-yl)butanoic acid (PubChem CID 82405484) has the molecular formula C7H9NO3S and a molecular weight of 187.22 g/mol. Its IUPAC name is 4-hydroxy-2-(1,2-thiazol-5-yl)butanoic acid.

Molecular Properties

Compound Name4-hydroxy-2-(1,2-thiazol-5-yl)butanoic acid
PubChem CID82405484
Molecular FormulaC7H9NO3S
Molecular Weight187.22 g/mol
Exact Mass187.03
IUPAC Name4-hydroxy-2-(1,2-thiazol-5-yl)butanoic acid
SMILESO=C(O)C(CCO)c1ccns1
InChIInChI=1S/C7H9NO3S/c9-4-2-5(7(10)11)6-1-3-8-12-6/h1,3,5,9H,2,4H2,(H,10,11)
InChIKeyRHHFLBKGLSBCJH-UHFFFAOYSA-N
XLogP0.69
TPSA70.42 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.22
LogP ≤ 50.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-hydroxy-2-(1,2-thiazol-5-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-hydroxy-2-(1,2-thiazol-5-yl)butanoic acid?
The IUPAC name of 4-hydroxy-2-(1,2-thiazol-5-yl)butanoic acid (CID 82405484) is 4-hydroxy-2-(1,2-thiazol-5-yl)butanoic acid.
What is the SMILES notation for 4-hydroxy-2-(1,2-thiazol-5-yl)butanoic acid?
The canonical SMILES for 4-hydroxy-2-(1,2-thiazol-5-yl)butanoic acid is O=C(O)C(CCO)c1ccns1.
What is the InChIKey of 4-hydroxy-2-(1,2-thiazol-5-yl)butanoic acid?
The InChIKey is RHHFLBKGLSBCJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3S/c9-4-2-5(7(10)11)6-1-3-8-12-6/h1,3,5,9H,2,4H2,(H,10,11).
What are the key properties of 4-hydroxy-2-(1,2-thiazol-5-yl)butanoic acid?
4-hydroxy-2-(1,2-thiazol-5-yl)butanoic acid has a molecular weight of 187.22 g/mol, XLogP of 0.69, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2-(1,2-thiazol-5-yl)butanoic acid is sourced from PubChem (CID 82405484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).