C7H7NO3S — CID 82406251
3-(1,2-thiazol-5-yl)oxetane-3-carboxylic acid (PubChem CID 82406251) has the molecular formula C7H7NO3S and a molecular weight of 185.20 g/mol. Its IUPAC name is 3-(1,2-thiazol-5-yl)oxetane-3-carboxylic acid.
| Compound Name | 3-(1,2-thiazol-5-yl)oxetane-3-carboxylic acid |
|---|---|
| PubChem CID | 82406251 |
| Molecular Formula | C7H7NO3S |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | 3-(1,2-thiazol-5-yl)oxetane-3-carboxylic acid |
| SMILES | O=C(O)C1(c2ccns2)COC1 |
| InChI | InChI=1S/C7H7NO3S/c9-6(10)7(3-11-4-7)5-1-2-8-12-5/h1-2H,3-4H2,(H,9,10) |
| InChIKey | MDDLDMRSXHTDIT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |