C9H12N2O2 — CID 82409015
3-(5-methyl-1,3-oxazol-2-yl)piperidin-4-one (PubChem CID 82409015) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 3-(5-methyl-1,3-oxazol-2-yl)piperidin-4-one.
| Compound Name | 3-(5-methyl-1,3-oxazol-2-yl)piperidin-4-one |
|---|---|
| PubChem CID | 82409015 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 3-(5-methyl-1,3-oxazol-2-yl)piperidin-4-one |
| SMILES | Cc1cnc(C2CNCCC2=O)o1 |
| InChI | InChI=1S/C9H12N2O2/c1-6-4-11-9(13-6)7-5-10-3-2-8(7)12/h4,7,10H,2-3,5H2,1H3 |
| InChIKey | IJBDMJMRJGUOIE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |