About 3-cyclopropyl-5-ethyl-1,2-thiazole-4-carbonitrile
3-cyclopropyl-5-ethyl-1,2-thiazole-4-carbonitrile (PubChem CID 82409870) has the molecular formula C9H10N2S
and a molecular weight of 178.26 g/mol. Its IUPAC name is 3-cyclopropyl-5-ethyl-1,2-thiazole-4-carbonitrile.
Analyze 3-cyclopropyl-5-ethyl-1,2-thiazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-5-ethyl-1,2-thiazole-4-carbonitrile?
The IUPAC name of 3-cyclopropyl-5-ethyl-1,2-thiazole-4-carbonitrile (CID 82409870) is 3-cyclopropyl-5-ethyl-1,2-thiazole-4-carbonitrile.
What is the SMILES notation for 3-cyclopropyl-5-ethyl-1,2-thiazole-4-carbonitrile?
The canonical SMILES for 3-cyclopropyl-5-ethyl-1,2-thiazole-4-carbonitrile is CCc1snc(C2CC2)c1C#N.
What is the InChIKey of 3-cyclopropyl-5-ethyl-1,2-thiazole-4-carbonitrile?
The InChIKey is UERROBGMFSNNIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2S/c1-2-8-7(5-10)9(11-12-8)6-3-4-6/h6H,2-4H2,1H3.
What are the key properties of 3-cyclopropyl-5-ethyl-1,2-thiazole-4-carbonitrile?
3-cyclopropyl-5-ethyl-1,2-thiazole-4-carbonitrile has a molecular weight of 178.26 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-5-ethyl-1,2-thiazole-4-carbonitrile is sourced from PubChem (CID 82409870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).