C10H13N3S — CID 91620610
5-amino-3-cyclohexyl-1,2-thiazole-4-carbonitrile (PubChem CID 91620610) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 5-amino-3-cyclohexyl-1,2-thiazole-4-carbonitrile.
| Compound Name | 5-amino-3-cyclohexyl-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 91620610 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 5-amino-3-cyclohexyl-1,2-thiazole-4-carbonitrile |
| SMILES | N#Cc1c(C2CCCCC2)nsc1N |
| InChI | InChI=1S/C10H13N3S/c11-6-8-9(13-14-10(8)12)7-4-2-1-3-5-7/h7H,1-5,12H2 |
| InChIKey | RUQXWFARONXARB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |