1-methylfuro[3,4-c]pyridine-4-carboxylic acid

C9H7NO3 — CID 82410647

IUPAC1-methylfuro[3,4-c]pyridine-4-carboxylic acid
SMILESCc1occ2c(C(=O)O)nccc12
InChIInChI=1S/C9H7NO3/c1-5-6-2-3-10-8(9(11)12)7(6)4-13-5/h2-4H,1H3,(H,11,12)
InChIKeyKLGOWSMFXUYBOM-UHFFFAOYSA-N
MW177.16 g/mol
LogP1.83
Rot. Bonds1

About 1-methylfuro[3,4-c]pyridine-4-carboxylic acid

1-methylfuro[3,4-c]pyridine-4-carboxylic acid (PubChem CID 82410647) has the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. Its IUPAC name is 1-methylfuro[3,4-c]pyridine-4-carboxylic acid.

Molecular Properties

Compound Name1-methylfuro[3,4-c]pyridine-4-carboxylic acid
PubChem CID82410647
Molecular FormulaC9H7NO3
Molecular Weight177.16 g/mol
Exact Mass177.04
IUPAC Name1-methylfuro[3,4-c]pyridine-4-carboxylic acid
SMILESCc1occ2c(C(=O)O)nccc12
InChIInChI=1S/C9H7NO3/c1-5-6-2-3-10-8(9(11)12)7(6)4-13-5/h2-4H,1H3,(H,11,12)
InChIKeyKLGOWSMFXUYBOM-UHFFFAOYSA-N
XLogP1.83
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.16
LogP ≤ 51.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-methylfuro[3,4-c]pyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methylfuro[3,4-c]pyridine-4-carboxylic acid?
The IUPAC name of 1-methylfuro[3,4-c]pyridine-4-carboxylic acid (CID 82410647) is 1-methylfuro[3,4-c]pyridine-4-carboxylic acid.
What is the SMILES notation for 1-methylfuro[3,4-c]pyridine-4-carboxylic acid?
The canonical SMILES for 1-methylfuro[3,4-c]pyridine-4-carboxylic acid is Cc1occ2c(C(=O)O)nccc12.
What is the InChIKey of 1-methylfuro[3,4-c]pyridine-4-carboxylic acid?
The InChIKey is KLGOWSMFXUYBOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3/c1-5-6-2-3-10-8(9(11)12)7(6)4-13-5/h2-4H,1H3,(H,11,12).
What are the key properties of 1-methylfuro[3,4-c]pyridine-4-carboxylic acid?
1-methylfuro[3,4-c]pyridine-4-carboxylic acid has a molecular weight of 177.16 g/mol, XLogP of 1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylfuro[3,4-c]pyridine-4-carboxylic acid is sourced from PubChem (CID 82410647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).