C10H9N3 — CID 82412113
2-(1H-pyrrolo[3,2-c]pyridin-3-yl)propanenitrile (PubChem CID 82412113) has the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)propanenitrile.
| Compound Name | 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)propanenitrile |
|---|---|
| PubChem CID | 82412113 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)propanenitrile |
| SMILES | CC(C#N)c1c[nH]c2ccncc12 |
| InChI | InChI=1S/C10H9N3/c1-7(4-11)8-6-13-10-2-3-12-5-9(8)10/h2-3,5-7,13H,1H3 |
| InChIKey | LUUYJJHEPWSLOR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |