C6H10N4S — CID 82412367
3-pyrrolidin-3-yl-1,2,4-thiadiazol-5-amine (PubChem CID 82412367) has the molecular formula C6H10N4S and a molecular weight of 170.24 g/mol. Its IUPAC name is 3-pyrrolidin-3-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-pyrrolidin-3-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 82412367 |
| Molecular Formula | C6H10N4S |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 3-pyrrolidin-3-yl-1,2,4-thiadiazol-5-amine |
| SMILES | Nc1nc(C2CCNC2)ns1 |
| InChI | InChI=1S/C6H10N4S/c7-6-9-5(10-11-6)4-1-2-8-3-4/h4,8H,1-3H2,(H2,7,9,10) |
| InChIKey | PXQFPKQMHACRKP-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |