C8H10N2O2 — CID 82414305
2-(1,3-oxazol-4-yl)piperidin-4-one (PubChem CID 82414305) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-(1,3-oxazol-4-yl)piperidin-4-one.
| Compound Name | 2-(1,3-oxazol-4-yl)piperidin-4-one |
|---|---|
| PubChem CID | 82414305 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 2-(1,3-oxazol-4-yl)piperidin-4-one |
| SMILES | O=C1CCNC(c2cocn2)C1 |
| InChI | InChI=1S/C8H10N2O2/c11-6-1-2-9-7(3-6)8-4-12-5-10-8/h4-5,7,9H,1-3H2 |
| InChIKey | QFKFMGJMIZTFDN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |