About 2-thieno[2,3-b]thiophen-5-ylpiperidin-4-one
2-thieno[2,3-b]thiophen-5-ylpiperidin-4-one (PubChem CID 82388922) has the molecular formula C11H11NOS2
and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-thieno[2,3-b]thiophen-5-ylpiperidin-4-one.
Molecular Properties
| Compound Name | 2-thieno[2,3-b]thiophen-5-ylpiperidin-4-one |
| PubChem CID | 82388922 |
| Molecular Formula | C11H11NOS2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 2-thieno[2,3-b]thiophen-5-ylpiperidin-4-one |
| SMILES | O=C1CCNC(c2cc3ccsc3s2)C1 |
| InChI | InChI=1S/C11H11NOS2/c13-8-1-3-12-9(6-8)10-5-7-2-4-14-11(7)15-10/h2,4-5,9,12H,1,3,6H2 |
| InChIKey | HIMARMQEFWKWSR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-thieno[2,3-b]thiophen-5-ylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thieno[2,3-b]thiophen-5-ylpiperidin-4-one?
The IUPAC name of 2-thieno[2,3-b]thiophen-5-ylpiperidin-4-one (CID 82388922) is 2-thieno[2,3-b]thiophen-5-ylpiperidin-4-one.
What is the SMILES notation for 2-thieno[2,3-b]thiophen-5-ylpiperidin-4-one?
The canonical SMILES for 2-thieno[2,3-b]thiophen-5-ylpiperidin-4-one is O=C1CCNC(c2cc3ccsc3s2)C1.
What is the InChIKey of 2-thieno[2,3-b]thiophen-5-ylpiperidin-4-one?
The InChIKey is HIMARMQEFWKWSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NOS2/c13-8-1-3-12-9(6-8)10-5-7-2-4-14-11(7)15-10/h2,4-5,9,12H,1,3,6H2.
What are the key properties of 2-thieno[2,3-b]thiophen-5-ylpiperidin-4-one?
2-thieno[2,3-b]thiophen-5-ylpiperidin-4-one has a molecular weight of 237.35 g/mol, XLogP of 2.96, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thieno[2,3-b]thiophen-5-ylpiperidin-4-one is sourced from PubChem (CID 82388922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).