About [1-(1,3-thiazol-5-yl)cyclopropyl]methanamine
[1-(1,3-thiazol-5-yl)cyclopropyl]methanamine (PubChem CID 82416500) has the molecular formula C7H10N2S
and a molecular weight of 154.24 g/mol. Its IUPAC name is [1-(1,3-thiazol-5-yl)cyclopropyl]methanamine.
Molecular Properties
| Compound Name | [1-(1,3-thiazol-5-yl)cyclopropyl]methanamine |
| PubChem CID | 82416500 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | [1-(1,3-thiazol-5-yl)cyclopropyl]methanamine |
| SMILES | NCC1(c2cncs2)CC1 |
| InChI | InChI=1S/C7H10N2S/c8-4-7(1-2-7)6-3-9-5-10-6/h3,5H,1-2,4,8H2 |
| InChIKey | BKDCQUOQEOTWSD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(1,3-thiazol-5-yl)cyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,3-thiazol-5-yl)cyclopropyl]methanamine?
The IUPAC name of [1-(1,3-thiazol-5-yl)cyclopropyl]methanamine (CID 82416500) is [1-(1,3-thiazol-5-yl)cyclopropyl]methanamine.
What is the SMILES notation for [1-(1,3-thiazol-5-yl)cyclopropyl]methanamine?
The canonical SMILES for [1-(1,3-thiazol-5-yl)cyclopropyl]methanamine is NCC1(c2cncs2)CC1.
What is the InChIKey of [1-(1,3-thiazol-5-yl)cyclopropyl]methanamine?
The InChIKey is BKDCQUOQEOTWSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2S/c8-4-7(1-2-7)6-3-9-5-10-6/h3,5H,1-2,4,8H2.
What are the key properties of [1-(1,3-thiazol-5-yl)cyclopropyl]methanamine?
[1-(1,3-thiazol-5-yl)cyclopropyl]methanamine has a molecular weight of 154.24 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,3-thiazol-5-yl)cyclopropyl]methanamine is sourced from PubChem (CID 82416500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).