C8H11NOS — CID 151113073
5-[1-(methoxymethyl)cyclopropyl]-1,3-thiazole (PubChem CID 151113073) has the molecular formula C8H11NOS and a molecular weight of 169.25 g/mol. Its IUPAC name is 5-[1-(methoxymethyl)cyclopropyl]-1,3-thiazole.
| Compound Name | 5-[1-(methoxymethyl)cyclopropyl]-1,3-thiazole |
|---|---|
| PubChem CID | 151113073 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 5-[1-(methoxymethyl)cyclopropyl]-1,3-thiazole |
| SMILES | COCC1(c2cncs2)CC1 |
| InChI | InChI=1S/C8H11NOS/c1-10-5-8(2-3-8)7-4-9-6-11-7/h4,6H,2-3,5H2,1H3 |
| InChIKey | MQOIKWZKJMEQJB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |