C7H12ClN3 — CID 129319570
[1-(1H-imidazol-5-yl)cyclopropyl]methanamine;hydrochloride (PubChem CID 129319570) has the molecular formula C7H12ClN3 and a molecular weight of 173.65 g/mol. Its IUPAC name is [1-(1H-imidazol-5-yl)cyclopropyl]methanamine;hydrochloride.
| Compound Name | [1-(1H-imidazol-5-yl)cyclopropyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 129319570 |
| Molecular Formula | C7H12ClN3 |
| Molecular Weight | 173.65 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | [1-(1H-imidazol-5-yl)cyclopropyl]methanamine;hydrochloride |
| SMILES | Cl.NCC1(c2cnc[nH]2)CC1 |
| InChI | InChI=1S/C7H11N3.ClH/c8-4-7(1-2-7)6-3-9-5-10-6;/h3,5H,1-2,4,8H2,(H,9,10);1H |
| InChIKey | HPVLDKTXWHDYTG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.65 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |