C7H11N3O — CID 82416934
6-(aminomethyl)-4-ethyl-1H-pyrimidin-2-one (PubChem CID 82416934) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is 6-(aminomethyl)-4-ethyl-1H-pyrimidin-2-one.
| Compound Name | 6-(aminomethyl)-4-ethyl-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 82416934 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 6-(aminomethyl)-4-ethyl-1H-pyrimidin-2-one |
| SMILES | CCc1cc(CN)[nH]c(=O)n1 |
| InChI | InChI=1S/C7H11N3O/c1-2-5-3-6(4-8)10-7(11)9-5/h3H,2,4,8H2,1H3,(H,9,10,11) |
| InChIKey | RBBQBQBBAYQJMH-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |