C7H8N2O2 — CID 82417180
(1S)-1-furo[3,4-d][1,3]oxazol-2-ylethanamine (PubChem CID 82417180) has the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. Its IUPAC name is (1S)-1-furo[3,4-d][1,3]oxazol-2-ylethanamine.
| Compound Name | (1S)-1-furo[3,4-d][1,3]oxazol-2-ylethanamine |
|---|---|
| PubChem CID | 82417180 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | (1S)-1-furo[3,4-d][1,3]oxazol-2-ylethanamine |
| SMILES | C[C@H](N)c1nc2cocc2o1 |
| InChI | InChI=1S/C7H8N2O2/c1-4(8)7-9-5-2-10-3-6(5)11-7/h2-4H,8H2,1H3/t4-/m0/s1 |
| InChIKey | KXRNIMQMBPCFLE-BYPYZUCNSA-N |
| XLogP | 1.44 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |