C10H11BrN2O — CID 82463467
1-(5-bromo-7-methyl-1,3-benzoxazol-2-yl)ethanamine (PubChem CID 82463467) has the molecular formula C10H11BrN2O and a molecular weight of 255.12 g/mol. Its IUPAC name is 1-(5-bromo-7-methyl-1,3-benzoxazol-2-yl)ethanamine.
| Compound Name | 1-(5-bromo-7-methyl-1,3-benzoxazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 82463467 |
| Molecular Formula | C10H11BrN2O |
| Molecular Weight | 255.12 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 1-(5-bromo-7-methyl-1,3-benzoxazol-2-yl)ethanamine |
| SMILES | Cc1cc(Br)cc2nc(C(C)N)oc12 |
| InChI | InChI=1S/C10H11BrN2O/c1-5-3-7(11)4-8-9(5)14-10(13-8)6(2)12/h3-4,6H,12H2,1-2H3 |
| InChIKey | ZZJKTMCKSGZHBC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.12 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |