C7H10N4 — CID 82417456
1-(5H-imidazo[1,2-b]pyrazol-2-yl)ethanamine (PubChem CID 82417456) has the molecular formula C7H10N4 and a molecular weight of 150.19 g/mol. Its IUPAC name is 1-(5H-imidazo[1,2-b]pyrazol-2-yl)ethanamine.
| Compound Name | 1-(5H-imidazo[1,2-b]pyrazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 82417456 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.19 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 1-(5H-imidazo[1,2-b]pyrazol-2-yl)ethanamine |
| SMILES | CC(N)c1cn2[nH]ccc2n1 |
| InChI | InChI=1S/C7H10N4/c1-5(8)6-4-11-7(10-6)2-3-9-11/h2-5,9H,8H2,1H3 |
| InChIKey | KVZLCYICLANNLE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |